C15H32O3S — CID 158872259
(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2,3,3-trimethylbutane (PubChem CID 158872259) has the molecular formula C15H32O3S and a molecular weight of 292.48 g/mol. Its IUPAC name is (2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2,3,3-trimethylbutane.
| Compound Name | (2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2,3,3-trimethylbutane |
|---|---|
| PubChem CID | 158872259 |
| Molecular Formula | C15H32O3S |
| Molecular Weight | 292.48 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | (2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2,3,3-trimethylbutane |
| SMILES | C[C@@H](CS(=O)(=O)CCCOCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H32O3S/c1-13(15(5,6)7)11-19(16,17)10-8-9-18-12-14(2,3)4/h13H,8-12H2,1-7H3/t13-/m0/s1 |
| InChIKey | QWRGHQNDPRTWAP-ZDUSSCGKSA-N |
| XLogP | 3.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|