C11H22O3S — CID 164830164
3-(4,4-dimethyl-1-methylsulfonylpentan-3-yl)oxetane (PubChem CID 164830164) has the molecular formula C11H22O3S and a molecular weight of 234.36 g/mol. Its IUPAC name is 3-(4,4-dimethyl-1-methylsulfonylpentan-3-yl)oxetane.
| Compound Name | 3-(4,4-dimethyl-1-methylsulfonylpentan-3-yl)oxetane |
|---|---|
| PubChem CID | 164830164 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 3-(4,4-dimethyl-1-methylsulfonylpentan-3-yl)oxetane |
| SMILES | CC(C)(C)C(CCS(C)(=O)=O)C1COC1 |
| InChI | InChI=1S/C11H22O3S/c1-11(2,3)10(9-7-14-8-9)5-6-15(4,12)13/h9-10H,5-8H2,1-4H3 |
| InChIKey | OQNLFHMXRMSOJU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |