C14H28O3S — CID 160736538
3-tert-butyloxetane;3-tert-butylthietane 1,1-dioxide (PubChem CID 160736538) has the molecular formula C14H28O3S and a molecular weight of 276.44 g/mol. Its IUPAC name is 3-tert-butyloxetane;3-tert-butylthietane 1,1-dioxide.
| Compound Name | 3-tert-butyloxetane;3-tert-butylthietane 1,1-dioxide |
|---|---|
| PubChem CID | 160736538 |
| Molecular Formula | C14H28O3S |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 3-tert-butyloxetane;3-tert-butylthietane 1,1-dioxide |
| SMILES | CC(C)(C)C1COC1.CC(C)(C)C1CS(=O)(=O)C1 |
| InChI | InChI=1S/C7H14O2S.C7H14O/c1-7(2,3)6-4-10(8,9)5-6;1-7(2,3)6-4-8-5-6/h6H,4-5H2,1-3H3;6H,4-5H2,1-3H3 |
| InChIKey | RVAHZQUHSXDSRF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |