C56H54O9S2 — CID 157086591
[4-[2-[4-[1,1-bis(4-methoxyphenyl)ethyl]phenyl]propan-2-yl]phenyl]methanol;bis(2-methylidene-5-methylsulfonylnaphthalen-1-one) (PubChem CID 157086591) has the molecular formula C56H54O9S2 and a molecular weight of 935.17 g/mol. Its IUPAC name is [4-[2-[4-[1,1-bis(4-methoxyphenyl)ethyl]phenyl]propan-2-yl]phenyl]methanol;bis(2-methylidene-5-methylsulfonylnaphthalen-1-one).
| Compound Name | [4-[2-[4-[1,1-bis(4-methoxyphenyl)ethyl]phenyl]propan-2-yl]phenyl]methanol;bis(2-methylidene-5-methylsulfonylnaphthalen-1-one) |
|---|---|
| PubChem CID | 157086591 |
| Molecular Formula | C56H54O9S2 |
| Molecular Weight | 935.17 g/mol |
| Exact Mass | 934.32 |
| IUPAC Name | [4-[2-[4-[1,1-bis(4-methoxyphenyl)ethyl]phenyl]propan-2-yl]phenyl]methanol;bis(2-methylidene-5-methylsulfonylnaphthalen-1-one) |
| SMILES | C=C1C=Cc2c(cccc2S(C)(=O)=O)C1=O.C=C1C=Cc2c(cccc2S(C)(=O)=O)C1=O.COc1ccc(C(C)(c2ccc(OC)cc2)c2ccc(C(C)(C)c3ccc(CO)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H34O3.2C12H10O3S/c1-31(2,24-8-6-23(22-33)7-9-24)25-10-12-26(13-11-25)32(3,27-14-18-29(34-4)19-15-27)28-16-20-30(35-5)21-17-28;2*1-8-6-7-9-10(12(8)13)4-3-5-11(9)16(2,14)15/h6-21,33H,22H2,1-5H3;2*3-7H,1H2,2H3 |
| InChIKey | AEDTVAWQZGMOTJ-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.17 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|