C32H26O4S — CID 164668200
(6aS)-11-(4-methoxyphenyl)-6a-[(4-methylphenyl)sulfonylmethyl]-6H-benzo[a]fluoren-5-one (PubChem CID 164668200) has the molecular formula C32H26O4S and a molecular weight of 506.62 g/mol. Its IUPAC name is (6aS)-11-(4-methoxyphenyl)-6a-[(4-methylphenyl)sulfonylmethyl]-6H-benzo[a]fluoren-5-one.
| Compound Name | (6aS)-11-(4-methoxyphenyl)-6a-[(4-methylphenyl)sulfonylmethyl]-6H-benzo[a]fluoren-5-one |
|---|---|
| PubChem CID | 164668200 |
| Molecular Formula | C32H26O4S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | (6aS)-11-(4-methoxyphenyl)-6a-[(4-methylphenyl)sulfonylmethyl]-6H-benzo[a]fluoren-5-one |
| SMILES | COc1ccc(C2=C3c4ccccc4C(=O)C[C@]3(CS(=O)(=O)c3ccc(C)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C32H26O4S/c1-21-11-17-24(18-12-21)37(34,35)20-32-19-29(33)25-7-3-4-8-26(25)31(32)30(27-9-5-6-10-28(27)32)22-13-15-23(36-2)16-14-22/h3-18H,19-20H2,1-2H3/t32-/m0/s1 |
| InChIKey | FENJWZQPUZMDLY-YTTGMZPUSA-N |
| XLogP | 6.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|