C15H20BNO4 — CID 157087069
1-[(3R,6S)-2-hydroxy-6-(2-oxopropyl)oxaborinan-3-yl]-3-pyridin-3-ylpropan-2-one (PubChem CID 157087069) has the molecular formula C15H20BNO4 and a molecular weight of 289.14 g/mol. Its IUPAC name is 1-[(3R,6S)-2-hydroxy-6-(2-oxopropyl)oxaborinan-3-yl]-3-pyridin-3-ylpropan-2-one.
| Compound Name | 1-[(3R,6S)-2-hydroxy-6-(2-oxopropyl)oxaborinan-3-yl]-3-pyridin-3-ylpropan-2-one |
|---|---|
| PubChem CID | 157087069 |
| Molecular Formula | C15H20BNO4 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-[(3R,6S)-2-hydroxy-6-(2-oxopropyl)oxaborinan-3-yl]-3-pyridin-3-ylpropan-2-one |
| SMILES | CC(=O)C[C@@H]1CC[C@H](CC(=O)Cc2cccnc2)B(O)O1 |
| InChI | InChI=1S/C15H20BNO4/c1-11(18)7-15-5-4-13(16(20)21-15)9-14(19)8-12-3-2-6-17-10-12/h2-3,6,10,13,15,20H,4-5,7-9H2,1H3/t13-,15+/m1/s1 |
| InChIKey | BDZSDOMTSXGZTA-HIFRSBDPSA-N |
| XLogP | 1.59 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|