C13H17BN2O5 — CID 163983798
2-[(3R)-2-hydroxy-3-[(2-pyridin-3-ylacetyl)amino]oxaborinan-6-yl]acetic acid (PubChem CID 163983798) has the molecular formula C13H17BN2O5 and a molecular weight of 292.10 g/mol. Its IUPAC name is 2-[(3R)-2-hydroxy-3-[(2-pyridin-3-ylacetyl)amino]oxaborinan-6-yl]acetic acid.
| Compound Name | 2-[(3R)-2-hydroxy-3-[(2-pyridin-3-ylacetyl)amino]oxaborinan-6-yl]acetic acid |
|---|---|
| PubChem CID | 163983798 |
| Molecular Formula | C13H17BN2O5 |
| Molecular Weight | 292.10 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[(3R)-2-hydroxy-3-[(2-pyridin-3-ylacetyl)amino]oxaborinan-6-yl]acetic acid |
| SMILES | O=C(O)CC1CC[C@H](NC(=O)Cc2cccnc2)B(O)O1 |
| InChI | InChI=1S/C13H17BN2O5/c17-12(6-9-2-1-5-15-8-9)16-11-4-3-10(7-13(18)19)21-14(11)20/h1-2,5,8,10-11,20H,3-4,6-7H2,(H,16,17)(H,18,19)/t10?,11-/m0/s1 |
| InChIKey | TUNXLQIRCXKADN-DTIOYNMSSA-N |
| XLogP | -0.22 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.10 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|