C26H34B2N4O10 — CID 158738551
2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid (PubChem CID 158738551) has the molecular formula C26H34B2N4O10 and a molecular weight of 584.20 g/mol. Its IUPAC name is 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid.
| Compound Name | 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid |
|---|---|
| PubChem CID | 158738551 |
| Molecular Formula | C26H34B2N4O10 |
| Molecular Weight | 584.20 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2ccccn2)B(O)O1.O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2ccccn2)B(O)O1 |
| InChI | InChI=1S/2C13H17BN2O5/c2*17-12(7-9-3-1-2-6-15-9)16-11-5-4-10(8-13(18)19)21-14(11)20/h2*1-3,6,10-11,20H,4-5,7-8H2,(H,16,17)(H,18,19)/t2*10-,11-/m00/s1 |
| InChIKey | ILZJJHHHCPYWFH-SGUUPRDWSA-N |
| XLogP | -0.44 |
| TPSA | 217.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|