About 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid
2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid (PubChem CID 158738551) has the molecular formula C26H34B2N4O10
and a molecular weight of 584.20 g/mol. Its IUPAC name is 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid |
| PubChem CID | 158738551 |
| Molecular Formula | C26H34B2N4O10 |
| Molecular Weight | 584.20 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2ccccn2)B(O)O1.O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2ccccn2)B(O)O1 |
| InChI | InChI=1S/2C13H17BN2O5/c2*17-12(7-9-3-1-2-6-15-9)16-11-5-4-10(8-13(18)19)21-14(11)20/h2*1-3,6,10-11,20H,4-5,7-8H2,(H,16,17)(H,18,19)/t2*10-,11-/m00/s1 |
| InChIKey | ILZJJHHHCPYWFH-SGUUPRDWSA-N |
| XLogP | -0.44 |
| TPSA | 217.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 584.20 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid?
The IUPAC name of 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid (CID 158738551) is 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid.
What is the SMILES notation for 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid?
The canonical SMILES for 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid is O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2ccccn2)B(O)O1.O=C(O)C[C@@H]1CC[C@H](NC(=O)Cc2ccccn2)B(O)O1.
What is the InChIKey of 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid?
The InChIKey is ILZJJHHHCPYWFH-SGUUPRDWSA-N. The full InChI is InChI=1S/2C13H17BN2O5/c2*17-12(7-9-3-1-2-6-15-9)16-11-5-4-10(8-13(18)19)21-14(11)20/h2*1-3,6,10-11,20H,4-5,7-8H2,(H,16,17)(H,18,19)/t2*10-,11-/m00/s1.
What are the key properties of 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid?
2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid has a molecular weight of 584.20 g/mol, XLogP of -0.44, 10 rotatable bonds, 6 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,6S)-2-hydroxy-3-[(2-pyridin-2-ylacetyl)amino]oxaborinan-6-yl]acetic acid is sourced from PubChem (CID 158738551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).