C12H14N2O4 — CID 117011050
2-[2-oxo-3-(pyridin-2-ylmethyl)-1,3-oxazinan-6-yl]acetic acid (PubChem CID 117011050) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-[2-oxo-3-(pyridin-2-ylmethyl)-1,3-oxazinan-6-yl]acetic acid.
| Compound Name | 2-[2-oxo-3-(pyridin-2-ylmethyl)-1,3-oxazinan-6-yl]acetic acid |
|---|---|
| PubChem CID | 117011050 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-[2-oxo-3-(pyridin-2-ylmethyl)-1,3-oxazinan-6-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(Cc2ccccn2)C(=O)O1 |
| InChI | InChI=1S/C12H14N2O4/c15-11(16)7-10-4-6-14(12(17)18-10)8-9-3-1-2-5-13-9/h1-3,5,10H,4,6-8H2,(H,15,16) |
| InChIKey | GWYVLEAOFTXTTN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |