C61H72O3V — CID 157087865
1-(ethenoxymethoxy)-4-[2-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]ethyl]benzene;4-[2-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]ethyl]phenol;vanadium (PubChem CID 157087865) has the molecular formula C61H72O3V and a molecular weight of 904.19 g/mol. Its IUPAC name is 1-(ethenoxymethoxy)-4-[2-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]ethyl]benzene;4-[2-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]ethyl]phenol;vanadium.
| Compound Name | 1-(ethenoxymethoxy)-4-[2-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]ethyl]benzene;4-[2-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]ethyl]phenol;vanadium |
|---|---|
| PubChem CID | 157087865 |
| Molecular Formula | C61H72O3V |
| Molecular Weight | 904.19 g/mol |
| Exact Mass | 903.49 |
| IUPAC Name | 1-(ethenoxymethoxy)-4-[2-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]ethyl]benzene;4-[2-[4-[4-(4-propylcyclohexyl)phenyl]phenyl]ethyl]phenol;vanadium |
| SMILES | C=COCOc1ccc(CCc2ccc(-c3ccc(C4CCC(CCC)CC4)cc3)cc2)cc1.CCCC1CCC(c2ccc(-c3ccc(CCc4ccc(O)cc4)cc3)cc2)CC1.[V] |
| InChI | InChI=1S/C32H38O2.C29H34O.V/c1-3-5-25-8-14-28(15-9-25)30-18-20-31(21-19-30)29-16-10-26(11-17-29)6-7-27-12-22-32(23-13-27)34-24-33-4-2;1-2-3-22-6-12-25(13-7-22)27-16-18-28(19-17-27)26-14-8-23(9-15-26)4-5-24-10-20-29(30)21-11-24;/h4,10-13,16-23,25,28H,2-3,5-9,14-15,24H2,1H3;8-11,14-22,25,30H,2-7,12-13H2,1H3; |
| InChIKey | WJGMCQXZZKHWEE-UHFFFAOYSA-N |
| XLogP | 16.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.19 |
| LogP ≤ 5 | 16.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|