C24H19ClF2N4 — CID 157093113
7-(3-azabicyclo[3.2.0]heptan-3-yl)-2-[5-(5-chloro-2,4-difluorophenyl)-2H-pyrrol-4-yl]-1,5-naphthyridine (PubChem CID 157093113) has the molecular formula C24H19ClF2N4 and a molecular weight of 436.89 g/mol. Its IUPAC name is 7-(3-azabicyclo[3.2.0]heptan-3-yl)-2-[5-(5-chloro-2,4-difluorophenyl)-2H-pyrrol-4-yl]-1,5-naphthyridine.
| Compound Name | 7-(3-azabicyclo[3.2.0]heptan-3-yl)-2-[5-(5-chloro-2,4-difluorophenyl)-2H-pyrrol-4-yl]-1,5-naphthyridine |
|---|---|
| PubChem CID | 157093113 |
| Molecular Formula | C24H19ClF2N4 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 7-(3-azabicyclo[3.2.0]heptan-3-yl)-2-[5-(5-chloro-2,4-difluorophenyl)-2H-pyrrol-4-yl]-1,5-naphthyridine |
| SMILES | Fc1cc(F)c(C2=NCC=C2c2ccc3ncc(N4CC5CCC5C4)cc3n2)cc1Cl |
| InChI | InChI=1S/C24H19ClF2N4/c25-18-8-17(19(26)9-20(18)27)24-16(5-6-28-24)21-3-4-22-23(30-21)7-15(10-29-22)31-11-13-1-2-14(13)12-31/h3-5,7-10,13-14H,1-2,6,11-12H2 |
| InChIKey | AEWZNXNJKNUCBE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|