C22H19ClF2N6 — CID 146661917
6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-methyl-N-[(3R)-pyrrolidin-3-yl]-1,5-naphthyridin-3-amine (PubChem CID 146661917) has the molecular formula C22H19ClF2N6 and a molecular weight of 440.89 g/mol. Its IUPAC name is 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-methyl-N-[(3R)-pyrrolidin-3-yl]-1,5-naphthyridin-3-amine.
| Compound Name | 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-methyl-N-[(3R)-pyrrolidin-3-yl]-1,5-naphthyridin-3-amine |
|---|---|
| PubChem CID | 146661917 |
| Molecular Formula | C22H19ClF2N6 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 6-[5-(5-chloro-2,4-difluorophenyl)-1H-pyrazol-4-yl]-N-methyl-N-[(3R)-pyrrolidin-3-yl]-1,5-naphthyridin-3-amine |
| SMILES | CN(c1cnc2ccc(-c3cn[nH]c3-c3cc(Cl)c(F)cc3F)nc2c1)[C@@H]1CCNC1 |
| InChI | InChI=1S/C22H19ClF2N6/c1-31(12-4-5-26-9-12)13-6-21-20(27-10-13)3-2-19(29-21)15-11-28-30-22(15)14-7-16(23)18(25)8-17(14)24/h2-3,6-8,10-12,26H,4-5,9H2,1H3,(H,28,30)/t12-/m1/s1 |
| InChIKey | WBYODULGNVUCCW-GFCCVEGCSA-N |
| XLogP | 4.42 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|