About 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate
2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate (PubChem CID 157094840) has the molecular formula C14H12ClNO4
and a molecular weight of 293.71 g/mol. Its IUPAC name is 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate.
Molecular Properties
| Compound Name | 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate |
| PubChem CID | 157094840 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate |
| SMILES | CC(=O)COC(=O)COc1ccc2c(Cl)cccc2n1 |
| InChI | InChI=1S/C14H12ClNO4/c1-9(17)7-20-14(18)8-19-13-6-5-10-11(15)3-2-4-12(10)16-13/h2-6H,7-8H2,1H3 |
| InChIKey | AFBWARYHPMWFQV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate?
The IUPAC name of 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate (CID 157094840) is 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate.
What is the SMILES notation for 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate?
The canonical SMILES for 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate is CC(=O)COC(=O)COc1ccc2c(Cl)cccc2n1.
What is the InChIKey of 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate?
The InChIKey is AFBWARYHPMWFQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO4/c1-9(17)7-20-14(18)8-19-13-6-5-10-11(15)3-2-4-12(10)16-13/h2-6H,7-8H2,1H3.
What are the key properties of 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate?
2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate has a molecular weight of 293.71 g/mol, XLogP of 2.40, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate is sourced from PubChem (CID 157094840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).