2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate

C14H12ClNO4 — CID 157094840

IUPAC2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate
SMILESCC(=O)COC(=O)COc1ccc2c(Cl)cccc2n1
InChIInChI=1S/C14H12ClNO4/c1-9(17)7-20-14(18)8-19-13-6-5-10-11(15)3-2-4-12(10)16-13/h2-6H,7-8H2,1H3
InChIKeyAFBWARYHPMWFQV-UHFFFAOYSA-N
MW293.71 g/mol
LogP2.40
Rot. Bonds5

About 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate

2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate (PubChem CID 157094840) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate.

Molecular Properties

Compound Name2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate
PubChem CID157094840
Molecular FormulaC14H12ClNO4
Molecular Weight293.71 g/mol
Exact Mass293.05
IUPAC Name2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate
SMILESCC(=O)COC(=O)COc1ccc2c(Cl)cccc2n1
InChIInChI=1S/C14H12ClNO4/c1-9(17)7-20-14(18)8-19-13-6-5-10-11(15)3-2-4-12(10)16-13/h2-6H,7-8H2,1H3
InChIKeyAFBWARYHPMWFQV-UHFFFAOYSA-N
XLogP2.40
TPSA65.49 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.71
LogP ≤ 52.40
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate?
The IUPAC name of 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate (CID 157094840) is 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate.
What is the SMILES notation for 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate?
The canonical SMILES for 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate is CC(=O)COC(=O)COc1ccc2c(Cl)cccc2n1.
What is the InChIKey of 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate?
The InChIKey is AFBWARYHPMWFQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO4/c1-9(17)7-20-14(18)8-19-13-6-5-10-11(15)3-2-4-12(10)16-13/h2-6H,7-8H2,1H3.
What are the key properties of 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate?
2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate has a molecular weight of 293.71 g/mol, XLogP of 2.40, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropyl 2-(5-chloroquinolin-2-yl)oxyacetate is sourced from PubChem (CID 157094840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).