C32H40BBrN4O2 — CID 157096250
5-bromo-1H-pyrrolo[2,3-b]pyridine;5-(cyclohexen-1-yl)-1H-pyrrolo[2,3-b]pyridine;2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 157096250) has the molecular formula C32H40BBrN4O2 and a molecular weight of 603.41 g/mol. Its IUPAC name is 5-bromo-1H-pyrrolo[2,3-b]pyridine;5-(cyclohexen-1-yl)-1H-pyrrolo[2,3-b]pyridine;2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 5-bromo-1H-pyrrolo[2,3-b]pyridine;5-(cyclohexen-1-yl)-1H-pyrrolo[2,3-b]pyridine;2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 157096250 |
| Molecular Formula | C32H40BBrN4O2 |
| Molecular Weight | 603.41 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | 5-bromo-1H-pyrrolo[2,3-b]pyridine;5-(cyclohexen-1-yl)-1H-pyrrolo[2,3-b]pyridine;2-(cyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Brc1cnc2[nH]ccc2c1.C1=C(c2cnc3[nH]ccc3c2)CCCC1.CC1(C)OB(C2=CCCCC2)OC1(C)C |
| InChI | InChI=1S/C13H14N2.C12H21BO2.C7H5BrN2/c1-2-4-10(5-3-1)12-8-11-6-7-14-13(11)15-9-12;1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10;8-6-3-5-1-2-9-7(5)10-4-6/h4,6-9H,1-3,5H2,(H,14,15);8H,5-7,9H2,1-4H3;1-4H,(H,9,10) |
| InChIKey | AFFXOLJNZFDWMB-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.41 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|