C27H25FN6O — CID 157097768
4-[6-(4-ethynylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-N-[(1S)-1-(4-fluorophenyl)ethyl]piperazine-1-carboxamide (PubChem CID 157097768) has the molecular formula C27H25FN6O and a molecular weight of 468.54 g/mol. Its IUPAC name is 4-[6-(4-ethynylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-N-[(1S)-1-(4-fluorophenyl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-[6-(4-ethynylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-N-[(1S)-1-(4-fluorophenyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 157097768 |
| Molecular Formula | C27H25FN6O |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 4-[6-(4-ethynylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]-N-[(1S)-1-(4-fluorophenyl)ethyl]piperazine-1-carboxamide |
| SMILES | C#Cc1ccc(-c2cc3c(N4CCN(C(=O)N[C@@H](C)c5ccc(F)cc5)CC4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C27H25FN6O/c1-3-19-4-6-21(7-5-19)24-16-23-25(32-24)29-17-30-26(23)33-12-14-34(15-13-33)27(35)31-18(2)20-8-10-22(28)11-9-20/h1,4-11,16-18H,12-15H2,2H3,(H,31,35)(H,29,30,32)/t18-/m0/s1 |
| InChIKey | VMFKNWMBSLNRFB-SFHVURJKSA-N |
| XLogP | 4.34 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|