C18H18FIN6O — CID 90114428
N-[(4-fluorophenyl)methyl]-4-(6-iodo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 90114428) has the molecular formula C18H18FIN6O and a molecular weight of 480.29 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-(6-iodo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-(6-iodo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 90114428 |
| Molecular Formula | C18H18FIN6O |
| Molecular Weight | 480.29 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-(6-iodo-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)N1CCN(c2ncnc3[nH]c(I)cc23)CC1 |
| InChI | InChI=1S/C18H18FIN6O/c19-13-3-1-12(2-4-13)10-21-18(27)26-7-5-25(6-8-26)17-14-9-15(20)24-16(14)22-11-23-17/h1-4,9,11H,5-8,10H2,(H,21,27)(H,22,23,24) |
| InChIKey | FMMIWNYJFXVBQQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|