C34H33N3O5 — CID 157099227
3-aminonaphthalene-2-carboxylic acid;ethyl 3-[(3-aminonaphthalene-2-carbonyl)-benzylamino]propanoate (PubChem CID 157099227) has the molecular formula C34H33N3O5 and a molecular weight of 563.65 g/mol. Its IUPAC name is 3-aminonaphthalene-2-carboxylic acid;ethyl 3-[(3-aminonaphthalene-2-carbonyl)-benzylamino]propanoate.
| Compound Name | 3-aminonaphthalene-2-carboxylic acid;ethyl 3-[(3-aminonaphthalene-2-carbonyl)-benzylamino]propanoate |
|---|---|
| PubChem CID | 157099227 |
| Molecular Formula | C34H33N3O5 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 3-aminonaphthalene-2-carboxylic acid;ethyl 3-[(3-aminonaphthalene-2-carbonyl)-benzylamino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)C(=O)c1cc2ccccc2cc1N.Nc1cc2ccccc2cc1C(=O)O |
| InChI | InChI=1S/C23H24N2O3.C11H9NO2/c1-2-28-22(26)12-13-25(16-17-8-4-3-5-9-17)23(27)20-14-18-10-6-7-11-19(18)15-21(20)24;12-10-6-8-4-2-1-3-7(8)5-9(10)11(13)14/h3-11,14-15H,2,12-13,16,24H2,1H3;1-6H,12H2,(H,13,14) |
| InChIKey | AFONWRONNHNVIF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|