C23H28BrNO4 — CID 43910716
ethyl 3-[benzyl-(5-bromo-2-butoxybenzoyl)amino]propanoate (PubChem CID 43910716) has the molecular formula C23H28BrNO4 and a molecular weight of 462.38 g/mol. Its IUPAC name is ethyl 3-[benzyl-(5-bromo-2-butoxybenzoyl)amino]propanoate.
| Compound Name | ethyl 3-[benzyl-(5-bromo-2-butoxybenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 43910716 |
| Molecular Formula | C23H28BrNO4 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | ethyl 3-[benzyl-(5-bromo-2-butoxybenzoyl)amino]propanoate |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)N(CCC(=O)OCC)Cc1ccccc1 |
| InChI | InChI=1S/C23H28BrNO4/c1-3-5-15-29-21-12-11-19(24)16-20(21)23(27)25(14-13-22(26)28-4-2)17-18-9-7-6-8-10-18/h6-12,16H,3-5,13-15,17H2,1-2H3 |
| InChIKey | YUOJQVKOJABBBG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|