C26H31F4N7O5 — CID 157104392
(2S)-2-azido-2-(4,4-difluorocyclohexyl)acetic acid;(4S)-3-[(2S)-2-azido-2-(4,4-difluorocyclohexyl)acetyl]-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 157104392) has the molecular formula C26H31F4N7O5 and a molecular weight of 597.57 g/mol. Its IUPAC name is (2S)-2-azido-2-(4,4-difluorocyclohexyl)acetic acid;(4S)-3-[(2S)-2-azido-2-(4,4-difluorocyclohexyl)acetyl]-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | (2S)-2-azido-2-(4,4-difluorocyclohexyl)acetic acid;(4S)-3-[(2S)-2-azido-2-(4,4-difluorocyclohexyl)acetyl]-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 157104392 |
| Molecular Formula | C26H31F4N7O5 |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 597.23 |
| IUPAC Name | (2S)-2-azido-2-(4,4-difluorocyclohexyl)acetic acid;(4S)-3-[(2S)-2-azido-2-(4,4-difluorocyclohexyl)acetyl]-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=N[C@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)C1CCC(F)(F)CC1.[N-]=[N+]=N[C@H](C(=O)O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C18H20F2N4O3.C8H11F2N3O2/c19-18(20)8-6-13(7-9-18)15(22-23-21)16(25)24-14(11-27-17(24)26)10-12-4-2-1-3-5-12;9-8(10)3-1-5(2-4-8)6(7(14)15)12-13-11/h1-5,13-15H,6-11H2;5-6H,1-4H2,(H,14,15)/t14-,15-;6-/m00/s1 |
| InChIKey | AGDDKLGPVMXSAI-VBJOYHMQSA-N |
| XLogP | 6.66 |
| TPSA | 181.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|