C20H38O2 — CID 157106959
(4R)-2,13-dimethyl-4-(2-methylpropyl)tetradecane-3,10-dione (PubChem CID 157106959) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is (4R)-2,13-dimethyl-4-(2-methylpropyl)tetradecane-3,10-dione.
| Compound Name | (4R)-2,13-dimethyl-4-(2-methylpropyl)tetradecane-3,10-dione |
|---|---|
| PubChem CID | 157106959 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | (4R)-2,13-dimethyl-4-(2-methylpropyl)tetradecane-3,10-dione |
| SMILES | CC(C)CCC(=O)CCCCCC(CC(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C20H38O2/c1-15(2)12-13-19(21)11-9-7-8-10-18(14-16(3)4)20(22)17(5)6/h15-18H,7-14H2,1-6H3 |
| InChIKey | SHPMEXSMYJNUNM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|