About (4S)-4-ethyl-2,9-dimethyldecan-3-one
(4S)-4-ethyl-2,9-dimethyldecan-3-one (PubChem CID 164954852) has the molecular formula C14H28O
and a molecular weight of 212.38 g/mol. Its IUPAC name is (4S)-4-ethyl-2,9-dimethyldecan-3-one.
Molecular Properties
| Compound Name | (4S)-4-ethyl-2,9-dimethyldecan-3-one |
| PubChem CID | 164954852 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (4S)-4-ethyl-2,9-dimethyldecan-3-one |
| SMILES | CC[C@@H](CCCCC(C)C)C(=O)C(C)C |
| InChI | InChI=1S/C14H28O/c1-6-13(14(15)12(4)5)10-8-7-9-11(2)3/h11-13H,6-10H2,1-5H3/t13-/m0/s1 |
| InChIKey | BAQIVPPDGMJYBM-ZDUSSCGKSA-N |
| XLogP | 4.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-ethyl-2,9-dimethyldecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-ethyl-2,9-dimethyldecan-3-one?
The IUPAC name of (4S)-4-ethyl-2,9-dimethyldecan-3-one (CID 164954852) is (4S)-4-ethyl-2,9-dimethyldecan-3-one.
What is the SMILES notation for (4S)-4-ethyl-2,9-dimethyldecan-3-one?
The canonical SMILES for (4S)-4-ethyl-2,9-dimethyldecan-3-one is CC[C@@H](CCCCC(C)C)C(=O)C(C)C.
What is the InChIKey of (4S)-4-ethyl-2,9-dimethyldecan-3-one?
The InChIKey is BAQIVPPDGMJYBM-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H28O/c1-6-13(14(15)12(4)5)10-8-7-9-11(2)3/h11-13H,6-10H2,1-5H3/t13-/m0/s1.
What are the key properties of (4S)-4-ethyl-2,9-dimethyldecan-3-one?
(4S)-4-ethyl-2,9-dimethyldecan-3-one has a molecular weight of 212.38 g/mol, XLogP of 4.45, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-ethyl-2,9-dimethyldecan-3-one is sourced from PubChem (CID 164954852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).