C23H24FN3O2S — CID 15710729
3-[3-[4-(3-fluorophenyl)piperazin-1-yl]propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide (PubChem CID 15710729) has the molecular formula C23H24FN3O2S and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-[3-[4-(3-fluorophenyl)piperazin-1-yl]propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide.
| Compound Name | 3-[3-[4-(3-fluorophenyl)piperazin-1-yl]propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
|---|---|
| PubChem CID | 15710729 |
| Molecular Formula | C23H24FN3O2S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[3-[4-(3-fluorophenyl)piperazin-1-yl]propyl]-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene 2,2-dioxide |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1CCCN1CCN(c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C23H24FN3O2S/c24-19-7-3-8-20(17-19)26-15-13-25(14-16-26)11-4-12-27-21-9-1-5-18-6-2-10-22(23(18)21)30(27,28)29/h1-3,5-10,17H,4,11-16H2 |
| InChIKey | GZVYNCBPEHDVIB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |