C13H14Cl2N6O4 — CID 157107930
5-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one;formamide;methyl 1-amino-3-chloropyrrole-2-carboxylate (PubChem CID 157107930) has the molecular formula C13H14Cl2N6O4 and a molecular weight of 389.20 g/mol. Its IUPAC name is 5-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one;formamide;methyl 1-amino-3-chloropyrrole-2-carboxylate.
| Compound Name | 5-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one;formamide;methyl 1-amino-3-chloropyrrole-2-carboxylate |
|---|---|
| PubChem CID | 157107930 |
| Molecular Formula | C13H14Cl2N6O4 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 5-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one;formamide;methyl 1-amino-3-chloropyrrole-2-carboxylate |
| SMILES | COC(=O)c1c(Cl)ccn1N.NC=O.O=c1[nH]cnn2ccc(Cl)c12 |
| InChI | InChI=1S/C6H4ClN3O.C6H7ClN2O2.CH3NO/c7-4-1-2-10-5(4)6(11)8-3-9-10;1-11-6(10)5-4(7)2-3-9(5)8;2-1-3/h1-3H,(H,8,9,11);2-3H,8H2,1H3;1H,(H2,2,3) |
| InChIKey | AGMZSRZXPYNZIE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 150.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|