C20H24Br2N4OSi — CID 157109889
5-bromo-1H-indazole;2-[(5-bromoindazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 157109889) has the molecular formula C20H24Br2N4OSi and a molecular weight of 524.33 g/mol. Its IUPAC name is 5-bromo-1H-indazole;2-[(5-bromoindazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 5-bromo-1H-indazole;2-[(5-bromoindazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 157109889 |
| Molecular Formula | C20H24Br2N4OSi |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 5-bromo-1H-indazole;2-[(5-bromoindazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Brc1ccc2[nH]ncc2c1.C[Si](C)(C)CCOCn1ncc2cc(Br)ccc21 |
| InChI | InChI=1S/C13H19BrN2OSi.C7H5BrN2/c1-18(2,3)7-6-17-10-16-13-5-4-12(14)8-11(13)9-15-16;8-6-1-2-7-5(3-6)4-9-10-7/h4-5,8-9H,6-7,10H2,1-3H3;1-4H,(H,9,10) |
| InChIKey | AGSMNGVFPPCATN-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|