C12H18F8S — CID 15711444
1-(1,1,2,2,3,3,4,4-octafluorobutylsulfanyl)octane (PubChem CID 15711444) has the molecular formula C12H18F8S and a molecular weight of 346.33 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4-octafluorobutylsulfanyl)octane.
| Compound Name | 1-(1,1,2,2,3,3,4,4-octafluorobutylsulfanyl)octane |
|---|---|
| PubChem CID | 15711444 |
| Molecular Formula | C12H18F8S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4-octafluorobutylsulfanyl)octane |
| SMILES | CCCCCCCCSC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H18F8S/c1-2-3-4-5-6-7-8-21-12(19,20)11(17,18)10(15,16)9(13)14/h9H,2-8H2,1H3 |
| InChIKey | WBDODELWUVUIQY-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|