C13H25FS — CID 14113329
trans-(1R,2R)-1-fluoro-2-methylsulfanylcyclododecane (PubChem CID 14113329) has the molecular formula C13H25FS and a molecular weight of 232.41 g/mol. Its IUPAC name is trans-(1R,2R)-1-fluoro-2-methylsulfanylcyclododecane.
| Compound Name | trans-(1R,2R)-1-fluoro-2-methylsulfanylcyclododecane |
|---|---|
| PubChem CID | 14113329 |
| Molecular Formula | C13H25FS |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | trans-(1R,2R)-1-fluoro-2-methylsulfanylcyclododecane |
| SMILES | CS[C@@H]1CCCCCCCCCC[C@H]1F |
| InChI | InChI=1S/C13H25FS/c1-15-13-11-9-7-5-3-2-4-6-8-10-12(13)14/h12-13H,2-11H2,1H3/t12-,13-/m1/s1 |
| InChIKey | HLTWZCNLCKRJKC-CHWSQXEVSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |