C8H16OS2 — CID 130142292
2,6-bis(methylsulfanyl)cyclohexan-1-ol (PubChem CID 130142292) has the molecular formula C8H16OS2 and a molecular weight of 192.35 g/mol. Its IUPAC name is 2,6-bis(methylsulfanyl)cyclohexan-1-ol.
| Compound Name | 2,6-bis(methylsulfanyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 130142292 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2,6-bis(methylsulfanyl)cyclohexan-1-ol |
| SMILES | CSC1CCCC(SC)C1O |
| InChI | InChI=1S/C8H16OS2/c1-10-6-4-3-5-7(11-2)8(6)9/h6-9H,3-5H2,1-2H3 |
| InChIKey | QQRPXOWIPMSFLE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |