C6H12FNS — CID 118661743
(3S,4R)-3-fluoro-4-methylsulfanylpiperidine (PubChem CID 118661743) has the molecular formula C6H12FNS and a molecular weight of 149.23 g/mol. Its IUPAC name is (3S,4R)-3-fluoro-4-methylsulfanylpiperidine.
| Compound Name | (3S,4R)-3-fluoro-4-methylsulfanylpiperidine |
|---|---|
| PubChem CID | 118661743 |
| Molecular Formula | C6H12FNS |
| Molecular Weight | 149.23 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | (3S,4R)-3-fluoro-4-methylsulfanylpiperidine |
| SMILES | CS[C@@H]1CCNC[C@@H]1F |
| InChI | InChI=1S/C6H12FNS/c1-9-6-2-3-8-4-5(6)7/h5-6,8H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | ZITZSUCDSMMMLI-NTSWFWBYSA-N |
| XLogP | 1.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |