C8H16FN — CID 168979168
(3R,4R)-3-fluoro-4-propan-2-ylpiperidine (PubChem CID 168979168) has the molecular formula C8H16FN and a molecular weight of 145.22 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-4-propan-2-ylpiperidine.
| Compound Name | (3R,4R)-3-fluoro-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 168979168 |
| Molecular Formula | C8H16FN |
| Molecular Weight | 145.22 g/mol |
| Exact Mass | 145.13 |
| IUPAC Name | (3R,4R)-3-fluoro-4-propan-2-ylpiperidine |
| SMILES | CC(C)[C@H]1CCNC[C@@H]1F |
| InChI | InChI=1S/C8H16FN/c1-6(2)7-3-4-10-5-8(7)9/h6-8,10H,3-5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | PUIYNQFERAHNKL-SFYZADRCSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |