C8H16IN — CID 139491710
(3R,4S)-4-iodo-3-propan-2-ylpiperidine (PubChem CID 139491710) has the molecular formula C8H16IN and a molecular weight of 253.13 g/mol. Its IUPAC name is (3R,4S)-4-iodo-3-propan-2-ylpiperidine.
| Compound Name | (3R,4S)-4-iodo-3-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 139491710 |
| Molecular Formula | C8H16IN |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | (3R,4S)-4-iodo-3-propan-2-ylpiperidine |
| SMILES | CC(C)[C@@H]1CNCC[C@@H]1I |
| InChI | InChI=1S/C8H16IN/c1-6(2)7-5-10-4-3-8(7)9/h6-8,10H,3-5H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | MOAJIRRZDBCDHD-YUMQZZPRSA-N |
| XLogP | 2.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|