C7H14IN — CID 134386985
(3R,4S)-3-ethyl-4-iodopiperidine (PubChem CID 134386985) has the molecular formula C7H14IN and a molecular weight of 239.10 g/mol. Its IUPAC name is (3R,4S)-3-ethyl-4-iodopiperidine.
| Compound Name | (3R,4S)-3-ethyl-4-iodopiperidine |
|---|---|
| PubChem CID | 134386985 |
| Molecular Formula | C7H14IN |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | (3R,4S)-3-ethyl-4-iodopiperidine |
| SMILES | CC[C@@H]1CNCC[C@@H]1I |
| InChI | InChI=1S/C7H14IN/c1-2-6-5-9-4-3-7(6)8/h6-7,9H,2-5H2,1H3/t6-,7+/m1/s1 |
| InChIKey | OKYPCSMKVBUOME-RQJHMYQMSA-N |
| XLogP | 1.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|