C13H17Cl2N — CID 79310849
4-(3,5-dichlorophenyl)-3-ethylpiperidine (PubChem CID 79310849) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-3-ethylpiperidine.
| Compound Name | 4-(3,5-dichlorophenyl)-3-ethylpiperidine |
|---|---|
| PubChem CID | 79310849 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-3-ethylpiperidine |
| SMILES | CCC1CNCCC1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N/c1-2-9-8-16-4-3-13(9)10-5-11(14)7-12(15)6-10/h5-7,9,13,16H,2-4,8H2,1H3 |
| InChIKey | BEUVKKFYJNQMNR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |