C5H12ClFN2 — CID 170923054
(3R,4S)-3-fluoropiperidin-4-amine;hydrochloride (PubChem CID 170923054) has the molecular formula C5H12ClFN2 and a molecular weight of 154.62 g/mol. Its IUPAC name is (3R,4S)-3-fluoropiperidin-4-amine;hydrochloride.
| Compound Name | (3R,4S)-3-fluoropiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 170923054 |
| Molecular Formula | C5H12ClFN2 |
| Molecular Weight | 154.62 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | (3R,4S)-3-fluoropiperidin-4-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCNC[C@H]1F |
| InChI | InChI=1S/C5H11FN2.ClH/c6-4-3-8-2-1-5(4)7;/h4-5,8H,1-3,7H2;1H/t4-,5+;/m1./s1 |
| InChIKey | KTJVVPSRASXPKE-JBUOLDKXSA-N |
| XLogP | 0.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.62 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |