C22H27F3N6O — CID 157116906
4-[5-(1-cyclobutylpyrazol-4-yl)-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 157116906) has the molecular formula C22H27F3N6O and a molecular weight of 448.49 g/mol. Its IUPAC name is 4-[5-(1-cyclobutylpyrazol-4-yl)-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-(1-cyclobutylpyrazol-4-yl)-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 157116906 |
| Molecular Formula | C22H27F3N6O |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-[5-(1-cyclobutylpyrazol-4-yl)-2-[[(2R)-1,1,1-trifluoropropan-2-yl]amino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | C[C@@H](Nc1ncc2c(-c3cnn(C4CCC4)c3)cc(C3CCC(O)CC3)n2n1)C(F)(F)F |
| InChI | InChI=1S/C22H27F3N6O/c1-13(22(23,24)25)28-21-26-11-20-18(15-10-27-30(12-15)16-3-2-4-16)9-19(31(20)29-21)14-5-7-17(32)8-6-14/h9-14,16-17,32H,2-8H2,1H3,(H,28,29)/t13-,14?,17?/m1/s1 |
| InChIKey | PMLIWLCNIQPHRA-TUBUQKNSSA-N |
| XLogP | 4.70 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |