C23H28F3N5O — CID 158194050
4-[5-(1-cyclobutylpyrazol-4-yl)-2-[(2S)-3,3,3-trifluoro-2-methylpropyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol (PubChem CID 158194050) has the molecular formula C23H28F3N5O and a molecular weight of 447.51 g/mol. Its IUPAC name is 4-[5-(1-cyclobutylpyrazol-4-yl)-2-[(2S)-3,3,3-trifluoro-2-methylpropyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[5-(1-cyclobutylpyrazol-4-yl)-2-[(2S)-3,3,3-trifluoro-2-methylpropyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 158194050 |
| Molecular Formula | C23H28F3N5O |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-[5-(1-cyclobutylpyrazol-4-yl)-2-[(2S)-3,3,3-trifluoro-2-methylpropyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]cyclohexan-1-ol |
| SMILES | C[C@@H](Cc1ncc2c(-c3cnn(C4CCC4)c3)cc(C3CCC(O)CC3)n2n1)C(F)(F)F |
| InChI | InChI=1S/C23H28F3N5O/c1-14(23(24,25)26)9-22-27-12-21-19(16-11-28-30(13-16)17-3-2-4-17)10-20(31(21)29-22)15-5-7-18(32)8-6-15/h10-15,17-18,32H,2-9H2,1H3/t14-,15?,18?/m0/s1 |
| InChIKey | SYJQOJXJEJTVEW-SYJJWHGVSA-N |
| XLogP | 5.08 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |