C22H23N3O4 — CID 157118543
2-(2-amino-2-oxoethyl)-6-[4-(3-methoxyphenyl)butanoyl]-1H-indole-3-carboxamide (PubChem CID 157118543) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)-6-[4-(3-methoxyphenyl)butanoyl]-1H-indole-3-carboxamide.
| Compound Name | 2-(2-amino-2-oxoethyl)-6-[4-(3-methoxyphenyl)butanoyl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 157118543 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)-6-[4-(3-methoxyphenyl)butanoyl]-1H-indole-3-carboxamide |
| SMILES | COc1cccc(CCCC(=O)c2ccc3c(C(N)=O)c(CC(N)=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-29-15-6-2-4-13(10-15)5-3-7-19(26)14-8-9-16-17(11-14)25-18(12-20(23)27)21(16)22(24)28/h2,4,6,8-11,25H,3,5,7,12H2,1H3,(H2,23,27)(H2,24,28) |
| InChIKey | AHRMJOQHIGRDQC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |