C10H15FO3 — CID 157119479
methyl (1R,2R,3R)-2-fluoro-3-hydroxy-2-prop-2-enylcyclopentane-1-carboxylate (PubChem CID 157119479) has the molecular formula C10H15FO3 and a molecular weight of 202.22 g/mol. Its IUPAC name is methyl (1R,2R,3R)-2-fluoro-3-hydroxy-2-prop-2-enylcyclopentane-1-carboxylate.
| Compound Name | methyl (1R,2R,3R)-2-fluoro-3-hydroxy-2-prop-2-enylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 157119479 |
| Molecular Formula | C10H15FO3 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | methyl (1R,2R,3R)-2-fluoro-3-hydroxy-2-prop-2-enylcyclopentane-1-carboxylate |
| SMILES | C=CC[C@]1(F)[C@H](O)CC[C@@H]1C(=O)OC |
| InChI | InChI=1S/C10H15FO3/c1-3-6-10(11)7(9(13)14-2)4-5-8(10)12/h3,7-8,12H,1,4-6H2,2H3/t7-,8-,10-/m1/s1 |
| InChIKey | DXUCSYVOUCFHRS-NQMVMOMDSA-N |
| XLogP | 1.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|