C17H19N2O3S- — CID 157122355
1,3-dimethyl-5-[3-oxo-3-[4-(sulfinatoamino)anilino]propyl]benzene (PubChem CID 157122355) has the molecular formula C17H19N2O3S- and a molecular weight of 331.42 g/mol. Its IUPAC name is 1,3-dimethyl-5-[3-oxo-3-[4-(sulfinatoamino)anilino]propyl]benzene.
| Compound Name | 1,3-dimethyl-5-[3-oxo-3-[4-(sulfinatoamino)anilino]propyl]benzene |
|---|---|
| PubChem CID | 157122355 |
| Molecular Formula | C17H19N2O3S- |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1,3-dimethyl-5-[3-oxo-3-[4-(sulfinatoamino)anilino]propyl]benzene |
| SMILES | Cc1cc(C)cc(CCC(=O)Nc2ccc(NS(=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H20N2O3S/c1-12-9-13(2)11-14(10-12)3-8-17(20)18-15-4-6-16(7-5-15)19-23(21)22/h4-7,9-11,19H,3,8H2,1-2H3,(H,18,20)(H,21,22)/p-1 |
| InChIKey | OROJSWDZWOQXAI-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|