C27H23N2+ — CID 157122919
2,5-dimethyl-10-phenyl-7-(trideuteriomethyl)-10-aza-5-azoniapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15,17,19-nonaene (PubChem CID 157122919) has the molecular formula C27H23N2+ and a molecular weight of 378.51 g/mol. Its IUPAC name is 2,5-dimethyl-10-phenyl-7-(trideuteriomethyl)-10-aza-5-azoniapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15,17,19-nonaene.
| Compound Name | 2,5-dimethyl-10-phenyl-7-(trideuteriomethyl)-10-aza-5-azoniapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 157122919 |
| Molecular Formula | C27H23N2+ |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 2,5-dimethyl-10-phenyl-7-(trideuteriomethyl)-10-aza-5-azoniapentacyclo[11.7.0.03,11.04,9.015,20]icosa-1,3(11),4(9),5,7,12,15,17,19-nonaene |
| SMILES | [2H]C([2H])([2H])c1cc2c(c3c(C)c4c(cc3n2-c2ccccc2)Cc2ccccc2-4)[n+](C)c1 |
| InChI | InChI=1S/C27H23N2/c1-17-13-24-27(28(3)16-17)26-18(2)25-20(14-19-9-7-8-12-22(19)25)15-23(26)29(24)21-10-5-4-6-11-21/h4-13,15-16H,14H2,1-3H3/q+1/i1D3 |
| InChIKey | DZYUPXMDOIVIEI-FIBGUPNXSA-N |
| XLogP | 5.80 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|