C31H29N2+ — CID 160742656
1-methyl-2-(2-methylphenyl)-3-(2,4,6-trimethylphenyl)-6H-indeno[1,2-e]benzimidazol-1-ium (PubChem CID 160742656) has the molecular formula C31H29N2+ and a molecular weight of 429.59 g/mol. Its IUPAC name is 1-methyl-2-(2-methylphenyl)-3-(2,4,6-trimethylphenyl)-6H-indeno[1,2-e]benzimidazol-1-ium.
| Compound Name | 1-methyl-2-(2-methylphenyl)-3-(2,4,6-trimethylphenyl)-6H-indeno[1,2-e]benzimidazol-1-ium |
|---|---|
| PubChem CID | 160742656 |
| Molecular Formula | C31H29N2+ |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-methyl-2-(2-methylphenyl)-3-(2,4,6-trimethylphenyl)-6H-indeno[1,2-e]benzimidazol-1-ium |
| SMILES | Cc1cc(C)c(-n2c(-c3ccccc3C)[n+](C)c3c4c(ccc32)Cc2ccccc2-4)c(C)c1 |
| InChI | InChI=1S/C31H29N2/c1-19-16-21(3)29(22(4)17-19)33-27-15-14-24-18-23-11-7-9-13-26(23)28(24)30(27)32(5)31(33)25-12-8-6-10-20(25)2/h6-17H,18H2,1-5H3/q+1 |
| InChIKey | PIRFSYFELJVONK-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|