C19H22N4 — CID 157123664
4-(3H-isoindol-1-yl)-N-[(1-methylpyrrolidin-3-yl)methyl]pyridin-2-amine (PubChem CID 157123664) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-(3H-isoindol-1-yl)-N-[(1-methylpyrrolidin-3-yl)methyl]pyridin-2-amine.
| Compound Name | 4-(3H-isoindol-1-yl)-N-[(1-methylpyrrolidin-3-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 157123664 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 4-(3H-isoindol-1-yl)-N-[(1-methylpyrrolidin-3-yl)methyl]pyridin-2-amine |
| SMILES | CN1CCC(CNc2cc(C3=NCc4ccccc43)ccn2)C1 |
| InChI | InChI=1S/C19H22N4/c1-23-9-7-14(13-23)11-21-18-10-15(6-8-20-18)19-17-5-3-2-4-16(17)12-22-19/h2-6,8,10,14H,7,9,11-13H2,1H3,(H,20,21) |
| InChIKey | AIGOGQOIKLSZFH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |