C13H18O5 — CID 15712429
[(3R,4S)-4-(cyclohexylmethyl)-2,5-dioxooxolan-3-yl] acetate (PubChem CID 15712429) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is [(3R,4S)-4-(cyclohexylmethyl)-2,5-dioxooxolan-3-yl] acetate.
| Compound Name | [(3R,4S)-4-(cyclohexylmethyl)-2,5-dioxooxolan-3-yl] acetate |
|---|---|
| PubChem CID | 15712429 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [(3R,4S)-4-(cyclohexylmethyl)-2,5-dioxooxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(=O)OC(=O)[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C13H18O5/c1-8(14)17-11-10(12(15)18-13(11)16)7-9-5-3-2-4-6-9/h9-11H,2-7H2,1H3/t10-,11+/m0/s1 |
| InChIKey | KAPRSGOPOVIDTB-WDEREUQCSA-N |
| XLogP | 1.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|