C30H51N3O5 — CID 157125881
4-methyl-N-[3-[3-[2-[10-[methyl(propyl)amino]-5-oxodecoxy]ethoxy]propanoylamino]propyl]benzamide (PubChem CID 157125881) has the molecular formula C30H51N3O5 and a molecular weight of 533.75 g/mol. Its IUPAC name is 4-methyl-N-[3-[3-[2-[10-[methyl(propyl)amino]-5-oxodecoxy]ethoxy]propanoylamino]propyl]benzamide.
| Compound Name | 4-methyl-N-[3-[3-[2-[10-[methyl(propyl)amino]-5-oxodecoxy]ethoxy]propanoylamino]propyl]benzamide |
|---|---|
| PubChem CID | 157125881 |
| Molecular Formula | C30H51N3O5 |
| Molecular Weight | 533.75 g/mol |
| Exact Mass | 533.38 |
| IUPAC Name | 4-methyl-N-[3-[3-[2-[10-[methyl(propyl)amino]-5-oxodecoxy]ethoxy]propanoylamino]propyl]benzamide |
| SMILES | CCCN(C)CCCCCC(=O)CCCCOCCOCCC(=O)NCCCNC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H51N3O5/c1-4-20-33(3)21-8-5-6-11-28(34)12-7-9-22-37-24-25-38-23-17-29(35)31-18-10-19-32-30(36)27-15-13-26(2)14-16-27/h13-16H,4-12,17-25H2,1-3H3,(H,31,35)(H,32,36) |
| InChIKey | GYBMMZDBSINIJL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|