C22H33NO5 — CID 58427304
N-[4-(4-methylphenyl)-4-oxobutyl]-2-[2-(4-oxoheptoxy)ethoxy]acetamide (PubChem CID 58427304) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-[4-(4-methylphenyl)-4-oxobutyl]-2-[2-(4-oxoheptoxy)ethoxy]acetamide.
| Compound Name | N-[4-(4-methylphenyl)-4-oxobutyl]-2-[2-(4-oxoheptoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 58427304 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N-[4-(4-methylphenyl)-4-oxobutyl]-2-[2-(4-oxoheptoxy)ethoxy]acetamide |
| SMILES | CCCC(=O)CCCOCCOCC(=O)NCCCC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H33NO5/c1-3-6-20(24)7-5-14-27-15-16-28-17-22(26)23-13-4-8-21(25)19-11-9-18(2)10-12-19/h9-12H,3-8,13-17H2,1-2H3,(H,23,26) |
| InChIKey | JUKHMCZHIFZNMH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|