About 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride
1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride (PubChem CID 157127278) has the molecular formula C23H26Cl3N3O2
and a molecular weight of 482.84 g/mol. Its IUPAC name is 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride.
Molecular Properties
| Compound Name | 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride |
| PubChem CID | 157127278 |
| Molecular Formula | C23H26Cl3N3O2 |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride |
| SMILES | CC(Cl)OC(=O)Cl.Cc1ccccc1-c1nc(C2CCNCC2)nc2ccccc12.Cl |
| InChI | InChI=1S/C20H21N3.C3H4Cl2O2.ClH/c1-14-6-2-3-7-16(14)19-17-8-4-5-9-18(17)22-20(23-19)15-10-12-21-13-11-15;1-2(4)7-3(5)6;/h2-9,15,21H,10-13H2,1H3;2H,1H3;1H |
| InChIKey | AIQPHKMXEXBXMO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride?
The IUPAC name of 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride (CID 157127278) is 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride.
What is the SMILES notation for 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride?
The canonical SMILES for 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride is CC(Cl)OC(=O)Cl.Cc1ccccc1-c1nc(C2CCNCC2)nc2ccccc12.Cl.
What is the InChIKey of 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride?
The InChIKey is AIQPHKMXEXBXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3.C3H4Cl2O2.ClH/c1-14-6-2-3-7-16(14)19-17-8-4-5-9-18(17)22-20(23-19)15-10-12-21-13-11-15;1-2(4)7-3(5)6;/h2-9,15,21H,10-13H2,1H3;2H,1H3;1H.
What are the key properties of 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride?
1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride has a molecular weight of 482.84 g/mol, XLogP of 6.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethyl carbonochloridate;4-(2-methylphenyl)-2-piperidin-4-ylquinazoline;hydrochloride is sourced from PubChem (CID 157127278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).