C10H11N3NaO5 — CID 157128184
CID 157128184 (PubChem CID 157128184) has the molecular formula C10H11N3NaO5 and a molecular weight of 276.20 g/mol.
| Compound Name | CID 157128184 |
|---|---|
| PubChem CID | 157128184 |
| Molecular Formula | C10H11N3NaO5 |
| Molecular Weight | 276.20 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | — |
| SMILES | CC(NC(N)=O)(C(=O)O)c1ccc([N+](=O)[O-])cc1.[Na] |
| InChI | InChI=1S/C10H11N3O5.Na/c1-10(8(14)15,12-9(11)16)6-2-4-7(5-3-6)13(17)18;/h2-5H,1H3,(H,14,15)(H3,11,12,16); |
| InChIKey | XNACHVBOOJUKTG-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|