[3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate

C38H36O8 — CID 157129087

IUPAC[3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate
SMILESCOc1ccc(C2=Cc3ccc(OC(C)=O)c(C)c3OC2)cc1.COc1ccc(C2=Cc3ccc(OC(C)=O)c(C)c3OC2)cc1
InChIInChI=1S/2C19H18O4/c2*1-12-18(23-13(2)20)9-6-15-10-16(11-22-19(12)15)14-4-7-17(21-3)8-5-14/h2*4-10H,11H2,1-3H3
InChIKeyAIVRQFVGGQRYHN-UHFFFAOYSA-N
MW620.70 g/mol
LogP7.72
Rot. Bonds6

About [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate

[3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate (PubChem CID 157129087) has the molecular formula C38H36O8 and a molecular weight of 620.70 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate.

Molecular Properties

Compound Name[3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate
PubChem CID157129087
Molecular FormulaC38H36O8
Molecular Weight620.70 g/mol
Exact Mass620.24
IUPAC Name[3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate
SMILESCOc1ccc(C2=Cc3ccc(OC(C)=O)c(C)c3OC2)cc1.COc1ccc(C2=Cc3ccc(OC(C)=O)c(C)c3OC2)cc1
InChIInChI=1S/2C19H18O4/c2*1-12-18(23-13(2)20)9-6-15-10-16(11-22-19(12)15)14-4-7-17(21-3)8-5-14/h2*4-10H,11H2,1-3H3
InChIKeyAIVRQFVGGQRYHN-UHFFFAOYSA-N
XLogP7.72
TPSA89.52 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds6
Heavy Atoms46
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500620.70
LogP ≤ 57.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate?
The IUPAC name of [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate (CID 157129087) is [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate.
What is the SMILES notation for [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate?
The canonical SMILES for [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate is COc1ccc(C2=Cc3ccc(OC(C)=O)c(C)c3OC2)cc1.COc1ccc(C2=Cc3ccc(OC(C)=O)c(C)c3OC2)cc1.
What is the InChIKey of [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate?
The InChIKey is AIVRQFVGGQRYHN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C19H18O4/c2*1-12-18(23-13(2)20)9-6-15-10-16(11-22-19(12)15)14-4-7-17(21-3)8-5-14/h2*4-10H,11H2,1-3H3.
What are the key properties of [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate?
[3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate has a molecular weight of 620.70 g/mol, XLogP of 7.72, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(4-methoxyphenyl)-8-methyl-2H-chromen-7-yl] acetate is sourced from PubChem (CID 157129087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).