C17H27N2O+ — CID 157130459
3-aminopropyl-diethyl-(2-oxo-1-phenylbut-3-enyl)azanium (PubChem CID 157130459) has the molecular formula C17H27N2O+ and a molecular weight of 275.42 g/mol. Its IUPAC name is 3-aminopropyl-diethyl-(2-oxo-1-phenylbut-3-enyl)azanium.
| Compound Name | 3-aminopropyl-diethyl-(2-oxo-1-phenylbut-3-enyl)azanium |
|---|---|
| PubChem CID | 157130459 |
| Molecular Formula | C17H27N2O+ |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 3-aminopropyl-diethyl-(2-oxo-1-phenylbut-3-enyl)azanium |
| SMILES | C=CC(=O)C(c1ccccc1)[N+](CC)(CC)CCCN |
| InChI | InChI=1S/C17H27N2O/c1-4-16(20)17(15-11-8-7-9-12-15)19(5-2,6-3)14-10-13-18/h4,7-9,11-12,17H,1,5-6,10,13-14,18H2,2-3H3/q+1 |
| InChIKey | AIZVNFGDPBHWIE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|