About azane;sulfonylmethane
azane;sulfonylmethane (PubChem CID 157131409) has the molecular formula CH5NO2S
and a molecular weight of 95.12 g/mol. Its IUPAC name is azane;sulfonylmethane.
Molecular Properties
| Compound Name | azane;sulfonylmethane |
| PubChem CID | 157131409 |
| Molecular Formula | CH5NO2S |
| Molecular Weight | 95.12 g/mol |
| Exact Mass | 95.00 |
| IUPAC Name | azane;sulfonylmethane |
| SMILES | C=S(=O)=O.N |
| InChI | InChI=1S/CH2O2S.H3N/c1-4(2)3;/h1H2;1H3 |
| InChIKey | AJCULLWNABDTRT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 95.12 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze azane;sulfonylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;sulfonylmethane?
The IUPAC name of azane;sulfonylmethane (CID 157131409) is azane;sulfonylmethane.
What is the SMILES notation for azane;sulfonylmethane?
The canonical SMILES for azane;sulfonylmethane is C=S(=O)=O.N.
What is the InChIKey of azane;sulfonylmethane?
The InChIKey is AJCULLWNABDTRT-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O2S.H3N/c1-4(2)3;/h1H2;1H3.
What are the key properties of azane;sulfonylmethane?
azane;sulfonylmethane has a molecular weight of 95.12 g/mol, XLogP of -0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;sulfonylmethane is sourced from PubChem (CID 157131409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).