C15H21N5O3 — CID 157131879
(2S)-2,6-diaminohexanoic acid;quinoxaline-5-carboxamide (PubChem CID 157131879) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;quinoxaline-5-carboxamide.
| Compound Name | (2S)-2,6-diaminohexanoic acid;quinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 157131879 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;quinoxaline-5-carboxamide |
| SMILES | NC(=O)c1cccc2nccnc12.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H7N3O.C6H14N2O2/c10-9(13)6-2-1-3-7-8(6)12-5-4-11-7;7-4-2-1-3-5(8)6(9)10/h1-5H,(H2,10,13);5H,1-4,7-8H2,(H,9,10)/t;5-/m.0/s1 |
| InChIKey | AJEAVYATGFGJPJ-ZSCHJXSPSA-N |
| XLogP | 0.26 |
| TPSA | 158.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|